C20H13BrFN3O3 — CID 74762770
(2Z,4E)-5-(4-bromophenyl)-1-(4-fluoro-2-nitrophenyl)-2-imidazol-1-ylpenta-2,4-dien-1-one (PubChem CID 74762770) has the molecular formula C20H13BrFN3O3 and a molecular weight of 442.24 g/mol. Its IUPAC name is (2Z,4E)-5-(4-bromophenyl)-1-(4-fluoro-2-nitrophenyl)-2-imidazol-1-ylpenta-2,4-dien-1-one.
| Compound Name | (2Z,4E)-5-(4-bromophenyl)-1-(4-fluoro-2-nitrophenyl)-2-imidazol-1-ylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 74762770 |
| Molecular Formula | C20H13BrFN3O3 |
| Molecular Weight | 442.24 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | (2Z,4E)-5-(4-bromophenyl)-1-(4-fluoro-2-nitrophenyl)-2-imidazol-1-ylpenta-2,4-dien-1-one |
| SMILES | O=C(/C(=C/C=C/c1ccc(Br)cc1)n1ccnc1)c1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H13BrFN3O3/c21-15-6-4-14(5-7-15)2-1-3-18(24-11-10-23-13-24)20(26)17-9-8-16(22)12-19(17)25(27)28/h1-13H/b2-1+,18-3- |
| InChIKey | RLIFCRHKNFYPRD-WMXJQNAUSA-N |
| XLogP | 5.13 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.24 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|