C14H11BrN2O — CID 141430595
5-(4-bromophenyl)-2-imidazol-1-ylpenta-2,4-dienal (PubChem CID 141430595) has the molecular formula C14H11BrN2O and a molecular weight of 303.16 g/mol. Its IUPAC name is 5-(4-bromophenyl)-2-imidazol-1-ylpenta-2,4-dienal.
| Compound Name | 5-(4-bromophenyl)-2-imidazol-1-ylpenta-2,4-dienal |
|---|---|
| PubChem CID | 141430595 |
| Molecular Formula | C14H11BrN2O |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 5-(4-bromophenyl)-2-imidazol-1-ylpenta-2,4-dienal |
| SMILES | O=CC(=CC=Cc1ccc(Br)cc1)n1ccnc1 |
| InChI | InChI=1S/C14H11BrN2O/c15-13-6-4-12(5-7-13)2-1-3-14(10-18)17-9-8-16-11-17/h1-11H |
| InChIKey | UYIRPAMOFQERDM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|