C7H8N2 — CID 10363782
1,8a-dihydroimidazo[1,2-a]pyridine (PubChem CID 10363782) has the molecular formula C7H8N2 and a molecular weight of 120.15 g/mol. Its IUPAC name is 1,8a-dihydroimidazo[1,2-a]pyridine.
| Compound Name | 1,8a-dihydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 10363782 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 1,8a-dihydroimidazo[1,2-a]pyridine |
| SMILES | C1=CC2NC=CN2C=C1 |
| InChI | InChI=1S/C7H8N2/c1-2-5-9-6-4-8-7(9)3-1/h1-8H |
| InChIKey | OFNNNCPCYWMBBH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |