C16H26N4 — CID 103641544
N'-butan-2-yl-N'-methyl-N-[(1-methylbenzimidazol-2-yl)methyl]ethane-1,2-diamine (PubChem CID 103641544) has the molecular formula C16H26N4 and a molecular weight of 274.41 g/mol. Its IUPAC name is N'-butan-2-yl-N'-methyl-N-[(1-methylbenzimidazol-2-yl)methyl]ethane-1,2-diamine.
| Compound Name | N'-butan-2-yl-N'-methyl-N-[(1-methylbenzimidazol-2-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 103641544 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | N'-butan-2-yl-N'-methyl-N-[(1-methylbenzimidazol-2-yl)methyl]ethane-1,2-diamine |
| SMILES | CCC(C)N(C)CCNCc1nc2ccccc2n1C |
| InChI | InChI=1S/C16H26N4/c1-5-13(2)19(3)11-10-17-12-16-18-14-8-6-7-9-15(14)20(16)4/h6-9,13,17H,5,10-12H2,1-4H3 |
| InChIKey | XVVPEACEQFPLDQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|