C24H29ClN2O2 — CID 10364384
3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-cyclobutyl-1-hydroxy-1-phenylpropan-2-one (PubChem CID 10364384) has the molecular formula C24H29ClN2O2 and a molecular weight of 412.96 g/mol. Its IUPAC name is 3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-cyclobutyl-1-hydroxy-1-phenylpropan-2-one.
| Compound Name | 3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-cyclobutyl-1-hydroxy-1-phenylpropan-2-one |
|---|---|
| PubChem CID | 10364384 |
| Molecular Formula | C24H29ClN2O2 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-cyclobutyl-1-hydroxy-1-phenylpropan-2-one |
| SMILES | O=C(CN1CCN(Cc2ccc(Cl)cc2)CC1)C(O)(c1ccccc1)C1CCC1 |
| InChI | InChI=1S/C24H29ClN2O2/c25-22-11-9-19(10-12-22)17-26-13-15-27(16-14-26)18-23(28)24(29,21-7-4-8-21)20-5-2-1-3-6-20/h1-3,5-6,9-12,21,29H,4,7-8,13-18H2 |
| InChIKey | SETLTJOYRUAMSH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |