C17H9Cl2N3OS — CID 1036478
(4R)-2-amino-4-(3,4-dichlorophenyl)-6-thiophen-2-yl-4H-pyran-3,5-dicarbonitrile (PubChem CID 1036478) has the molecular formula C17H9Cl2N3OS and a molecular weight of 374.25 g/mol. Its IUPAC name is (4R)-2-amino-4-(3,4-dichlorophenyl)-6-thiophen-2-yl-4H-pyran-3,5-dicarbonitrile.
| Compound Name | (4R)-2-amino-4-(3,4-dichlorophenyl)-6-thiophen-2-yl-4H-pyran-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 1036478 |
| Molecular Formula | C17H9Cl2N3OS |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | (4R)-2-amino-4-(3,4-dichlorophenyl)-6-thiophen-2-yl-4H-pyran-3,5-dicarbonitrile |
| SMILES | N#CC1=C(N)OC(c2cccs2)=C(C#N)[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H9Cl2N3OS/c18-12-4-3-9(6-13(12)19)15-10(7-20)16(14-2-1-5-24-14)23-17(22)11(15)8-21/h1-6,15H,22H2/t15-/m1/s1 |
| InChIKey | CBIVQVRTYQFXCF-OAHLLOKOSA-N |
| XLogP | 4.80 |
| TPSA | 82.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_C(7)', 'substructure': 'N/A'} |
|---|