About (4R)-2-amino-4-(3,4-dichlorophenyl)-6-thiophen-2-yl-4H-pyran-3,5-dicarbonitrile
(4R)-2-amino-4-(3,4-dichlorophenyl)-6-thiophen-2-yl-4H-pyran-3,5-dicarbonitrile (PubChem CID 1036478) has the molecular formula C17H9Cl2N3OS
and a molecular weight of 374.25 g/mol. Its IUPAC name is (4R)-2-amino-4-(3,4-dichlorophenyl)-6-thiophen-2-yl-4H-pyran-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | (4R)-2-amino-4-(3,4-dichlorophenyl)-6-thiophen-2-yl-4H-pyran-3,5-dicarbonitrile |
| PubChem CID | 1036478 |
| Molecular Formula | C17H9Cl2N3OS |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | (4R)-2-amino-4-(3,4-dichlorophenyl)-6-thiophen-2-yl-4H-pyran-3,5-dicarbonitrile |
| SMILES | N#CC1=C(N)OC(c2cccs2)=C(C#N)[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H9Cl2N3OS/c18-12-4-3-9(6-13(12)19)15-10(7-20)16(14-2-1-5-24-14)23-17(22)11(15)8-21/h1-6,15H,22H2/t15-/m1/s1 |
| InChIKey | CBIVQVRTYQFXCF-OAHLLOKOSA-N |
| XLogP | 4.80 |
| TPSA | 82.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dhp_amino_CN_C(7)', 'substructure': 'N/A'} |
|---|
Analyze (4R)-2-amino-4-(3,4-dichlorophenyl)-6-thiophen-2-yl-4H-pyran-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-amino-4-(3,4-dichlorophenyl)-6-thiophen-2-yl-4H-pyran-3,5-dicarbonitrile?
The IUPAC name of (4R)-2-amino-4-(3,4-dichlorophenyl)-6-thiophen-2-yl-4H-pyran-3,5-dicarbonitrile (CID 1036478) is (4R)-2-amino-4-(3,4-dichlorophenyl)-6-thiophen-2-yl-4H-pyran-3,5-dicarbonitrile.
What is the SMILES notation for (4R)-2-amino-4-(3,4-dichlorophenyl)-6-thiophen-2-yl-4H-pyran-3,5-dicarbonitrile?
The canonical SMILES for (4R)-2-amino-4-(3,4-dichlorophenyl)-6-thiophen-2-yl-4H-pyran-3,5-dicarbonitrile is N#CC1=C(N)OC(c2cccs2)=C(C#N)[C@H]1c1ccc(Cl)c(Cl)c1.
What is the InChIKey of (4R)-2-amino-4-(3,4-dichlorophenyl)-6-thiophen-2-yl-4H-pyran-3,5-dicarbonitrile?
The InChIKey is CBIVQVRTYQFXCF-OAHLLOKOSA-N. The full InChI is InChI=1S/C17H9Cl2N3OS/c18-12-4-3-9(6-13(12)19)15-10(7-20)16(14-2-1-5-24-14)23-17(22)11(15)8-21/h1-6,15H,22H2/t15-/m1/s1.
What are the key properties of (4R)-2-amino-4-(3,4-dichlorophenyl)-6-thiophen-2-yl-4H-pyran-3,5-dicarbonitrile?
(4R)-2-amino-4-(3,4-dichlorophenyl)-6-thiophen-2-yl-4H-pyran-3,5-dicarbonitrile has a molecular weight of 374.25 g/mol, XLogP of 4.80, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-amino-4-(3,4-dichlorophenyl)-6-thiophen-2-yl-4H-pyran-3,5-dicarbonitrile is sourced from PubChem (CID 1036478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).