C27H29N5O — CID 10365930
2-[4-[3-(benzhydrylamino)propanoyl]piperazin-1-yl]-2-pyridin-3-ylacetonitrile (PubChem CID 10365930) has the molecular formula C27H29N5O and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-[4-[3-(benzhydrylamino)propanoyl]piperazin-1-yl]-2-pyridin-3-ylacetonitrile.
| Compound Name | 2-[4-[3-(benzhydrylamino)propanoyl]piperazin-1-yl]-2-pyridin-3-ylacetonitrile |
|---|---|
| PubChem CID | 10365930 |
| Molecular Formula | C27H29N5O |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 2-[4-[3-(benzhydrylamino)propanoyl]piperazin-1-yl]-2-pyridin-3-ylacetonitrile |
| SMILES | N#CC(c1cccnc1)N1CCN(C(=O)CCNC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H29N5O/c28-20-25(24-12-7-14-29-21-24)31-16-18-32(19-17-31)26(33)13-15-30-27(22-8-3-1-4-9-22)23-10-5-2-6-11-23/h1-12,14,21,25,27,30H,13,15-19H2 |
| InChIKey | HDVFVJWHMDUXDW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |