C26H28ClN5O — CID 45262038
2-[4-[2-(benzhydrylamino)acetyl]piperazin-1-yl]-2-pyridin-3-ylacetonitrile;hydrochloride (PubChem CID 45262038) has the molecular formula C26H28ClN5O and a molecular weight of 462.00 g/mol. Its IUPAC name is 2-[4-[2-(benzhydrylamino)acetyl]piperazin-1-yl]-2-pyridin-3-ylacetonitrile;hydrochloride.
| Compound Name | 2-[4-[2-(benzhydrylamino)acetyl]piperazin-1-yl]-2-pyridin-3-ylacetonitrile;hydrochloride |
|---|---|
| PubChem CID | 45262038 |
| Molecular Formula | C26H28ClN5O |
| Molecular Weight | 462.00 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 2-[4-[2-(benzhydrylamino)acetyl]piperazin-1-yl]-2-pyridin-3-ylacetonitrile;hydrochloride |
| SMILES | Cl.N#CC(c1cccnc1)N1CCN(C(=O)CNC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H27N5O.ClH/c27-18-24(23-12-7-13-28-19-23)30-14-16-31(17-15-30)25(32)20-29-26(21-8-3-1-4-9-21)22-10-5-2-6-11-22;/h1-13,19,24,26,29H,14-17,20H2;1H |
| InChIKey | XGDWTQSBHYAMGO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.00 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |