C9H16N2O2 — CID 103668847
5-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]pyrrolidin-2-one (PubChem CID 103668847) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 5-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]pyrrolidin-2-one.
| Compound Name | 5-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 103668847 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 5-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]pyrrolidin-2-one |
| SMILES | O=C1CCC(CN2CC[C@@H](O)C2)N1 |
| InChI | InChI=1S/C9H16N2O2/c12-8-3-4-11(6-8)5-7-1-2-9(13)10-7/h7-8,12H,1-6H2,(H,10,13)/t7?,8-/m1/s1 |
| InChIKey | ZPGRSXOKNZFPRT-BRFYHDHCSA-N |
| XLogP | -0.67 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |