C27H37N5O2 — CID 10367147
1-[6-(dimethylamino)-3-methyl-2-[3-(4-phenylimidazol-1-yl)propoxy]phenyl]-3-pentylurea (PubChem CID 10367147) has the molecular formula C27H37N5O2 and a molecular weight of 463.63 g/mol. Its IUPAC name is 1-[6-(dimethylamino)-3-methyl-2-[3-(4-phenylimidazol-1-yl)propoxy]phenyl]-3-pentylurea.
| Compound Name | 1-[6-(dimethylamino)-3-methyl-2-[3-(4-phenylimidazol-1-yl)propoxy]phenyl]-3-pentylurea |
|---|---|
| PubChem CID | 10367147 |
| Molecular Formula | C27H37N5O2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | 1-[6-(dimethylamino)-3-methyl-2-[3-(4-phenylimidazol-1-yl)propoxy]phenyl]-3-pentylurea |
| SMILES | CCCCCNC(=O)Nc1c(N(C)C)ccc(C)c1OCCCn1cnc(-c2ccccc2)c1 |
| InChI | InChI=1S/C27H37N5O2/c1-5-6-10-16-28-27(33)30-25-24(31(3)4)15-14-21(2)26(25)34-18-11-17-32-19-23(29-20-32)22-12-8-7-9-13-22/h7-9,12-15,19-20H,5-6,10-11,16-18H2,1-4H3,(H2,28,30,33) |
| InChIKey | FEPXBGTVAGOACR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|