C25H33N5O2 — CID 10003115
1-tert-butyl-3-[2-(dimethylamino)-6-[3-(4-phenylimidazol-1-yl)propoxy]phenyl]urea (PubChem CID 10003115) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-(dimethylamino)-6-[3-(4-phenylimidazol-1-yl)propoxy]phenyl]urea.
| Compound Name | 1-tert-butyl-3-[2-(dimethylamino)-6-[3-(4-phenylimidazol-1-yl)propoxy]phenyl]urea |
|---|---|
| PubChem CID | 10003115 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 1-tert-butyl-3-[2-(dimethylamino)-6-[3-(4-phenylimidazol-1-yl)propoxy]phenyl]urea |
| SMILES | CN(C)c1cccc(OCCCn2cnc(-c3ccccc3)c2)c1NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C25H33N5O2/c1-25(2,3)28-24(31)27-23-21(29(4)5)13-9-14-22(23)32-16-10-15-30-17-20(26-18-30)19-11-7-6-8-12-19/h6-9,11-14,17-18H,10,15-16H2,1-5H3,(H2,27,28,31) |
| InChIKey | PIZKWMLQOPEHGM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|