C27H42N6O3 — CID 166633931
1-(cyclopentylmethyl)-1-[3-methoxy-4-(2-piperazin-1-ylethoxy)phenyl]-3-[3-(5-methylimidazol-1-yl)propyl]urea (PubChem CID 166633931) has the molecular formula C27H42N6O3 and a molecular weight of 498.67 g/mol. Its IUPAC name is 1-(cyclopentylmethyl)-1-[3-methoxy-4-(2-piperazin-1-ylethoxy)phenyl]-3-[3-(5-methylimidazol-1-yl)propyl]urea.
| Compound Name | 1-(cyclopentylmethyl)-1-[3-methoxy-4-(2-piperazin-1-ylethoxy)phenyl]-3-[3-(5-methylimidazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 166633931 |
| Molecular Formula | C27H42N6O3 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | 1-(cyclopentylmethyl)-1-[3-methoxy-4-(2-piperazin-1-ylethoxy)phenyl]-3-[3-(5-methylimidazol-1-yl)propyl]urea |
| SMILES | COc1cc(N(CC2CCCC2)C(=O)NCCCn2cncc2C)ccc1OCCN1CCNCC1 |
| InChI | InChI=1S/C27H42N6O3/c1-22-19-29-21-32(22)13-5-10-30-27(34)33(20-23-6-3-4-7-23)24-8-9-25(26(18-24)35-2)36-17-16-31-14-11-28-12-15-31/h8-9,18-19,21,23,28H,3-7,10-17,20H2,1-2H3,(H,30,34) |
| InChIKey | CHGAADMBFNIRHL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|