C29H40N6O2S — CID 166635250
1-[4-[4-(2-amino-4-pyridinyl)butoxy]-3-methoxyphenyl]-1-cyclopentyl-3-[3-(5-methylimidazol-1-yl)propyl]thiourea (PubChem CID 166635250) has the molecular formula C29H40N6O2S and a molecular weight of 536.75 g/mol. Its IUPAC name is 1-[4-[4-(2-amino-4-pyridinyl)butoxy]-3-methoxyphenyl]-1-cyclopentyl-3-[3-(5-methylimidazol-1-yl)propyl]thiourea.
| Compound Name | 1-[4-[4-(2-amino-4-pyridinyl)butoxy]-3-methoxyphenyl]-1-cyclopentyl-3-[3-(5-methylimidazol-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 166635250 |
| Molecular Formula | C29H40N6O2S |
| Molecular Weight | 536.75 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | 1-[4-[4-(2-amino-4-pyridinyl)butoxy]-3-methoxyphenyl]-1-cyclopentyl-3-[3-(5-methylimidazol-1-yl)propyl]thiourea |
| SMILES | COc1cc(N(C(=S)NCCCn2cncc2C)C2CCCC2)ccc1OCCCCc1ccnc(N)c1 |
| InChI | InChI=1S/C29H40N6O2S/c1-22-20-31-21-34(22)16-7-14-33-29(38)35(24-9-3-4-10-24)25-11-12-26(27(19-25)36-2)37-17-6-5-8-23-13-15-32-28(30)18-23/h11-13,15,18-21,24H,3-10,14,16-17H2,1-2H3,(H2,30,32)(H,33,38) |
| InChIKey | RORVVWGLVFPVCB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.75 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|