C12H17ClFNOS — CID 103684950
3-[(2-chloro-6-fluorophenyl)methylamino]-2-methylsulfanylbutan-1-ol (PubChem CID 103684950) has the molecular formula C12H17ClFNOS and a molecular weight of 277.79 g/mol. Its IUPAC name is 3-[(2-chloro-6-fluorophenyl)methylamino]-2-methylsulfanylbutan-1-ol.
| Compound Name | 3-[(2-chloro-6-fluorophenyl)methylamino]-2-methylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 103684950 |
| Molecular Formula | C12H17ClFNOS |
| Molecular Weight | 277.79 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 3-[(2-chloro-6-fluorophenyl)methylamino]-2-methylsulfanylbutan-1-ol |
| SMILES | CSC(CO)C(C)NCc1c(F)cccc1Cl |
| InChI | InChI=1S/C12H17ClFNOS/c1-8(12(7-16)17-2)15-6-9-10(13)4-3-5-11(9)14/h3-5,8,12,15-16H,6-7H2,1-2H3 |
| InChIKey | MUIDIXPGRUWSBW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.79 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |