C32H26N4O2 — CID 10368640
methyl 3-[4-[[3-[(4-cyanophenyl)methyl]imidazol-4-yl]methylamino]-2-phenylphenyl]benzoate (PubChem CID 10368640) has the molecular formula C32H26N4O2 and a molecular weight of 498.59 g/mol. Its IUPAC name is methyl 3-[4-[[3-[(4-cyanophenyl)methyl]imidazol-4-yl]methylamino]-2-phenylphenyl]benzoate.
| Compound Name | methyl 3-[4-[[3-[(4-cyanophenyl)methyl]imidazol-4-yl]methylamino]-2-phenylphenyl]benzoate |
|---|---|
| PubChem CID | 10368640 |
| Molecular Formula | C32H26N4O2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | methyl 3-[4-[[3-[(4-cyanophenyl)methyl]imidazol-4-yl]methylamino]-2-phenylphenyl]benzoate |
| SMILES | COC(=O)c1cccc(-c2ccc(NCc3cncn3Cc3ccc(C#N)cc3)cc2-c2ccccc2)c1 |
| InChI | InChI=1S/C32H26N4O2/c1-38-32(37)27-9-5-8-26(16-27)30-15-14-28(17-31(30)25-6-3-2-4-7-25)35-20-29-19-34-22-36(29)21-24-12-10-23(18-33)11-13-24/h2-17,19,22,35H,20-21H2,1H3 |
| InChIKey | PWGAFSATAZGSFE-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |