C30H26N4O2 — CID 10972793
3-[4-[[3-[(4-aminophenyl)methyl]imidazol-4-yl]methylamino]-2-phenylphenyl]benzoic acid (PubChem CID 10972793) has the molecular formula C30H26N4O2 and a molecular weight of 474.56 g/mol. Its IUPAC name is 3-[4-[[3-[(4-aminophenyl)methyl]imidazol-4-yl]methylamino]-2-phenylphenyl]benzoic acid.
| Compound Name | 3-[4-[[3-[(4-aminophenyl)methyl]imidazol-4-yl]methylamino]-2-phenylphenyl]benzoic acid |
|---|---|
| PubChem CID | 10972793 |
| Molecular Formula | C30H26N4O2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 3-[4-[[3-[(4-aminophenyl)methyl]imidazol-4-yl]methylamino]-2-phenylphenyl]benzoic acid |
| SMILES | Nc1ccc(Cn2cncc2CNc2ccc(-c3cccc(C(=O)O)c3)c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C30H26N4O2/c31-25-11-9-21(10-12-25)19-34-20-32-17-27(34)18-33-26-13-14-28(23-7-4-8-24(15-23)30(35)36)29(16-26)22-5-2-1-3-6-22/h1-17,20,33H,18-19,31H2,(H,35,36) |
| InChIKey | VUEFSYMFLPPOHV-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|