C32H27N5S — CID 44583420
5-phenyl-2-[[5-[[3-phenyl-4-(1,3-thiazol-5-yl)anilino]methyl]imidazol-1-yl]methyl]aniline (PubChem CID 44583420) has the molecular formula C32H27N5S and a molecular weight of 513.67 g/mol. Its IUPAC name is 5-phenyl-2-[[5-[[3-phenyl-4-(1,3-thiazol-5-yl)anilino]methyl]imidazol-1-yl]methyl]aniline.
| Compound Name | 5-phenyl-2-[[5-[[3-phenyl-4-(1,3-thiazol-5-yl)anilino]methyl]imidazol-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 44583420 |
| Molecular Formula | C32H27N5S |
| Molecular Weight | 513.67 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 5-phenyl-2-[[5-[[3-phenyl-4-(1,3-thiazol-5-yl)anilino]methyl]imidazol-1-yl]methyl]aniline |
| SMILES | Nc1cc(-c2ccccc2)ccc1Cn1cncc1CNc1ccc(-c2cncs2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C32H27N5S/c33-31-15-25(23-7-3-1-4-8-23)11-12-26(31)20-37-21-34-17-28(37)18-36-27-13-14-29(32-19-35-22-38-32)30(16-27)24-9-5-2-6-10-24/h1-17,19,21-22,36H,18,20,33H2 |
| InChIKey | UMFCZJAHFBTGDQ-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.67 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|