C31H32OS3 — CID 10369305
(2S,3S)-3-methyl-6-phenyl-2,4,4-tris(phenylsulfanyl)hexan-1-ol (PubChem CID 10369305) has the molecular formula C31H32OS3 and a molecular weight of 516.80 g/mol. Its IUPAC name is (2S,3S)-3-methyl-6-phenyl-2,4,4-tris(phenylsulfanyl)hexan-1-ol.
| Compound Name | (2S,3S)-3-methyl-6-phenyl-2,4,4-tris(phenylsulfanyl)hexan-1-ol |
|---|---|
| PubChem CID | 10369305 |
| Molecular Formula | C31H32OS3 |
| Molecular Weight | 516.80 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | (2S,3S)-3-methyl-6-phenyl-2,4,4-tris(phenylsulfanyl)hexan-1-ol |
| SMILES | C[C@@H]([C@@H](CO)Sc1ccccc1)C(CCc1ccccc1)(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C31H32OS3/c1-25(30(24-32)33-27-16-8-3-9-17-27)31(34-28-18-10-4-11-19-28,35-29-20-12-5-13-21-29)23-22-26-14-6-2-7-15-26/h2-21,25,30,32H,22-24H2,1H3/t25-,30+/m0/s1 |
| InChIKey | LPZUVKVJGBVRGZ-SETSBSEESA-N |
| XLogP | 8.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.80 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|