C30H50O5Si — CID 10369363
(1S,2R,5S,7R,9R,10S,12R,14R,15S,19S)-7-[tert-butyl(dimethyl)silyl]oxy-19-ethyl-15-hydroxy-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docos-3-ene-13,21-dione (PubChem CID 10369363) has the molecular formula C30H50O5Si and a molecular weight of 518.81 g/mol. Its IUPAC name is (1S,2R,5S,7R,9R,10S,12R,14R,15S,19S)-7-[tert-butyl(dimethyl)silyl]oxy-19-ethyl-15-hydroxy-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docos-3-ene-13,21-dione.
| Compound Name | (1S,2R,5S,7R,9R,10S,12R,14R,15S,19S)-7-[tert-butyl(dimethyl)silyl]oxy-19-ethyl-15-hydroxy-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docos-3-ene-13,21-dione |
|---|---|
| PubChem CID | 10369363 |
| Molecular Formula | C30H50O5Si |
| Molecular Weight | 518.81 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | (1S,2R,5S,7R,9R,10S,12R,14R,15S,19S)-7-[tert-butyl(dimethyl)silyl]oxy-19-ethyl-15-hydroxy-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docos-3-ene-13,21-dione |
| SMILES | CC[C@H]1CCC[C@H](O)[C@@H](C)C(=O)[C@@H]2C[C@@H]3[C@@H](C=C[C@@H]4C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]34)[C@@H]2CC(=O)O1 |
| InChI | InChI=1S/C30H50O5Si/c1-8-20-10-9-11-27(31)18(2)29(33)26-16-24-22(25(26)17-28(32)34-20)13-12-19-14-21(15-23(19)24)35-36(6,7)30(3,4)5/h12-13,18-27,31H,8-11,14-17H2,1-7H3/t18-,19-,20+,21-,22-,23-,24-,25+,26-,27+/m1/s1 |
| InChIKey | YSSPQNVMXYOAFR-JGSBZTSISA-N |
| XLogP | 6.30 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.81 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|