C33H54O5Si — CID 11734401
(1R,2S,5R,7S,9S,10R,14S,15R,19R)-19-ethyl-7-hydroxy-14-methyl-15-tri(propan-2-yl)silyloxy-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,21-dione (PubChem CID 11734401) has the molecular formula C33H54O5Si and a molecular weight of 558.88 g/mol. Its IUPAC name is (1R,2S,5R,7S,9S,10R,14S,15R,19R)-19-ethyl-7-hydroxy-14-methyl-15-tri(propan-2-yl)silyloxy-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,21-dione.
| Compound Name | (1R,2S,5R,7S,9S,10R,14S,15R,19R)-19-ethyl-7-hydroxy-14-methyl-15-tri(propan-2-yl)silyloxy-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,21-dione |
|---|---|
| PubChem CID | 11734401 |
| Molecular Formula | C33H54O5Si |
| Molecular Weight | 558.88 g/mol |
| Exact Mass | 558.37 |
| IUPAC Name | (1R,2S,5R,7S,9S,10R,14S,15R,19R)-19-ethyl-7-hydroxy-14-methyl-15-tri(propan-2-yl)silyloxy-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,21-dione |
| SMILES | CC[C@@H]1CCC[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)C(=O)C2=C[C@H]3[C@H](C=C[C@H]4C[C@H](O)C[C@H]34)[C@H]2CC(=O)O1 |
| InChI | InChI=1S/C33H54O5Si/c1-9-25-11-10-12-31(38-39(19(2)3,20(4)5)21(6)7)22(8)33(36)30-17-28-26(29(30)18-32(35)37-25)14-13-23-15-24(34)16-27(23)28/h13-14,17,19-29,31,34H,9-12,15-16,18H2,1-8H3/t22-,23-,24-,25+,26-,27-,28-,29+,31+/m0/s1 |
| InChIKey | UTUHHAWTIMMMDF-CXYNSINSSA-N |
| XLogP | 7.39 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.88 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|