C24H32O5 — CID 10046550
(1S,2R,5S,7R,9R,10S,14R,19S)-19-ethyl-7-hydroxy-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,15,21-trione (PubChem CID 10046550) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is (1S,2R,5S,7R,9R,10S,14R,19S)-19-ethyl-7-hydroxy-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,15,21-trione.
| Compound Name | (1S,2R,5S,7R,9R,10S,14R,19S)-19-ethyl-7-hydroxy-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,15,21-trione |
|---|---|
| PubChem CID | 10046550 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (1S,2R,5S,7R,9R,10S,14R,19S)-19-ethyl-7-hydroxy-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,15,21-trione |
| SMILES | CC[C@H]1CCCC(=O)[C@@H](C)C(=O)C2=C[C@@H]3[C@@H](C=C[C@@H]4C[C@@H](O)C[C@@H]34)[C@@H]2CC(=O)O1 |
| InChI | InChI=1S/C24H32O5/c1-3-16-5-4-6-22(26)13(2)24(28)21-11-19-17(20(21)12-23(27)29-16)8-7-14-9-15(25)10-18(14)19/h7-8,11,13-20,25H,3-6,9-10,12H2,1-2H3/t13-,14-,15-,16+,17-,18-,19-,20+/m1/s1 |
| InChIKey | UEUUWVGAPBWQOK-JULPPZSOSA-N |
| XLogP | 3.40 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|