C31H30F4N2O — CID 10369465
1'-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-7-(trifluoromethyl)spiro[1H-2-benzofuran-3,4'-piperidine] (PubChem CID 10369465) has the molecular formula C31H30F4N2O and a molecular weight of 522.59 g/mol. Its IUPAC name is 1'-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-7-(trifluoromethyl)spiro[1H-2-benzofuran-3,4'-piperidine].
| Compound Name | 1'-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-7-(trifluoromethyl)spiro[1H-2-benzofuran-3,4'-piperidine] |
|---|---|
| PubChem CID | 10369465 |
| Molecular Formula | C31H30F4N2O |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 1'-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-7-(trifluoromethyl)spiro[1H-2-benzofuran-3,4'-piperidine] |
| SMILES | Fc1ccc(-n2cc(CCCCN3CCC4(CC3)OCc3c(C(F)(F)F)cccc34)c3ccccc32)cc1 |
| InChI | InChI=1S/C31H30F4N2O/c32-23-11-13-24(14-12-23)37-20-22(25-7-1-2-10-29(25)37)6-3-4-17-36-18-15-30(16-19-36)27-8-5-9-28(31(33,34)35)26(27)21-38-30/h1-2,5,7-14,20H,3-4,6,15-19,21H2 |
| InChIKey | SZKLZVMYXKMBTH-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|