C12H8BrF2NO — CID 103695236
2-bromo-5-[(3,4-difluorophenyl)methoxy]pyridine (PubChem CID 103695236) has the molecular formula C12H8BrF2NO and a molecular weight of 300.10 g/mol. Its IUPAC name is 2-bromo-5-[(3,4-difluorophenyl)methoxy]pyridine.
| Compound Name | 2-bromo-5-[(3,4-difluorophenyl)methoxy]pyridine |
|---|---|
| PubChem CID | 103695236 |
| Molecular Formula | C12H8BrF2NO |
| Molecular Weight | 300.10 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 2-bromo-5-[(3,4-difluorophenyl)methoxy]pyridine |
| SMILES | Fc1ccc(COc2ccc(Br)nc2)cc1F |
| InChI | InChI=1S/C12H8BrF2NO/c13-12-4-2-9(6-16-12)17-7-8-1-3-10(14)11(15)5-8/h1-6H,7H2 |
| InChIKey | JDVJDRBXHOXNDD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.10 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|