C13H11F2NO2 — CID 18758409
[5-[(3,4-difluorophenyl)methoxy]-2-pyridinyl]methanol (PubChem CID 18758409) has the molecular formula C13H11F2NO2 and a molecular weight of 251.23 g/mol. Its IUPAC name is [5-[(3,4-difluorophenyl)methoxy]-2-pyridinyl]methanol.
| Compound Name | [5-[(3,4-difluorophenyl)methoxy]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 18758409 |
| Molecular Formula | C13H11F2NO2 |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | [5-[(3,4-difluorophenyl)methoxy]-2-pyridinyl]methanol |
| SMILES | OCc1ccc(OCc2ccc(F)c(F)c2)cn1 |
| InChI | InChI=1S/C13H11F2NO2/c14-12-4-1-9(5-13(12)15)8-18-11-3-2-10(7-17)16-6-11/h1-6,17H,7-8H2 |
| InChIKey | QILIXHXVBBUNKC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |