C14H14ClFN2O — CID 107879633
1-[5-[(4-chloro-3-fluorophenyl)methoxy]-2-pyridinyl]-N-methylmethanamine (PubChem CID 107879633) has the molecular formula C14H14ClFN2O and a molecular weight of 280.73 g/mol. Its IUPAC name is 1-[5-[(4-chloro-3-fluorophenyl)methoxy]-2-pyridinyl]-N-methylmethanamine.
| Compound Name | 1-[5-[(4-chloro-3-fluorophenyl)methoxy]-2-pyridinyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 107879633 |
| Molecular Formula | C14H14ClFN2O |
| Molecular Weight | 280.73 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1-[5-[(4-chloro-3-fluorophenyl)methoxy]-2-pyridinyl]-N-methylmethanamine |
| SMILES | CNCc1ccc(OCc2ccc(Cl)c(F)c2)cn1 |
| InChI | InChI=1S/C14H14ClFN2O/c1-17-7-11-3-4-12(8-18-11)19-9-10-2-5-13(15)14(16)6-10/h2-6,8,17H,7,9H2,1H3 |
| InChIKey | BKWZLUNMQFFSOV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.73 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |