C15H14ClFO — CID 107888358
1-chloro-4-[(3,5-dimethylphenoxy)methyl]-2-fluorobenzene (PubChem CID 107888358) has the molecular formula C15H14ClFO and a molecular weight of 264.73 g/mol. Its IUPAC name is 1-chloro-4-[(3,5-dimethylphenoxy)methyl]-2-fluorobenzene.
| Compound Name | 1-chloro-4-[(3,5-dimethylphenoxy)methyl]-2-fluorobenzene |
|---|---|
| PubChem CID | 107888358 |
| Molecular Formula | C15H14ClFO |
| Molecular Weight | 264.73 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 1-chloro-4-[(3,5-dimethylphenoxy)methyl]-2-fluorobenzene |
| SMILES | Cc1cc(C)cc(OCc2ccc(Cl)c(F)c2)c1 |
| InChI | InChI=1S/C15H14ClFO/c1-10-5-11(2)7-13(6-10)18-9-12-3-4-14(16)15(17)8-12/h3-8H,9H2,1-2H3 |
| InChIKey | FTQVWZZCRUEJQP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.73 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |