C20H29NO4 — CID 103695963
2-(3-methylcyclohexyl)-2-[phenylmethoxycarbonyl(propan-2-yl)amino]acetic acid (PubChem CID 103695963) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-(3-methylcyclohexyl)-2-[phenylmethoxycarbonyl(propan-2-yl)amino]acetic acid.
| Compound Name | 2-(3-methylcyclohexyl)-2-[phenylmethoxycarbonyl(propan-2-yl)amino]acetic acid |
|---|---|
| PubChem CID | 103695963 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 2-(3-methylcyclohexyl)-2-[phenylmethoxycarbonyl(propan-2-yl)amino]acetic acid |
| SMILES | CC1CCCC(C(C(=O)O)N(C(=O)OCc2ccccc2)C(C)C)C1 |
| InChI | InChI=1S/C20H29NO4/c1-14(2)21(20(24)25-13-16-9-5-4-6-10-16)18(19(22)23)17-11-7-8-15(3)12-17/h4-6,9-10,14-15,17-18H,7-8,11-13H2,1-3H3,(H,22,23) |
| InChIKey | ZPZBHODJQUVINR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |