C10H17N3OS — CID 103697870
1,1-diethyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]urea (PubChem CID 103697870) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 1,1-diethyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]urea.
| Compound Name | 1,1-diethyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 103697870 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 1,1-diethyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]urea |
| SMILES | CCN(CC)C(=O)NCc1ncc(C)s1 |
| InChI | InChI=1S/C10H17N3OS/c1-4-13(5-2)10(14)12-7-9-11-6-8(3)15-9/h6H,4-5,7H2,1-3H3,(H,12,14) |
| InChIKey | AJUXSQHOHKBPSX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |