C9H18N2OS — CID 103698014
1,1-diethyl-3-(thiolan-3-yl)urea (PubChem CID 103698014) has the molecular formula C9H18N2OS and a molecular weight of 202.32 g/mol. Its IUPAC name is 1,1-diethyl-3-(thiolan-3-yl)urea.
| Compound Name | 1,1-diethyl-3-(thiolan-3-yl)urea |
|---|---|
| PubChem CID | 103698014 |
| Molecular Formula | C9H18N2OS |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1,1-diethyl-3-(thiolan-3-yl)urea |
| SMILES | CCN(CC)C(=O)NC1CCSC1 |
| InChI | InChI=1S/C9H18N2OS/c1-3-11(4-2)9(12)10-8-5-6-13-7-8/h8H,3-7H2,1-2H3,(H,10,12) |
| InChIKey | QPWJEGMMIOYSHH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |