C15H31NO — CID 103698837
4-methyl-1-[(3,3,5-trimethylcyclohexyl)amino]pentan-2-ol (PubChem CID 103698837) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is 4-methyl-1-[(3,3,5-trimethylcyclohexyl)amino]pentan-2-ol.
| Compound Name | 4-methyl-1-[(3,3,5-trimethylcyclohexyl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 103698837 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | 4-methyl-1-[(3,3,5-trimethylcyclohexyl)amino]pentan-2-ol |
| SMILES | CC(C)CC(O)CNC1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C15H31NO/c1-11(2)6-14(17)10-16-13-7-12(3)8-15(4,5)9-13/h11-14,16-17H,6-10H2,1-5H3 |
| InChIKey | MIXLJCMIESFLGC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |