C26H29BrN6S — CID 10369961
1-[3-[(5-bromo-2-pyridinyl)-(naphthalen-1-ylmethyl)amino]propyl]-3-[3-(1H-imidazol-5-yl)propyl]thiourea (PubChem CID 10369961) has the molecular formula C26H29BrN6S and a molecular weight of 537.53 g/mol. Its IUPAC name is 1-[3-[(5-bromo-2-pyridinyl)-(naphthalen-1-ylmethyl)amino]propyl]-3-[3-(1H-imidazol-5-yl)propyl]thiourea.
| Compound Name | 1-[3-[(5-bromo-2-pyridinyl)-(naphthalen-1-ylmethyl)amino]propyl]-3-[3-(1H-imidazol-5-yl)propyl]thiourea |
|---|---|
| PubChem CID | 10369961 |
| Molecular Formula | C26H29BrN6S |
| Molecular Weight | 537.53 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | 1-[3-[(5-bromo-2-pyridinyl)-(naphthalen-1-ylmethyl)amino]propyl]-3-[3-(1H-imidazol-5-yl)propyl]thiourea |
| SMILES | S=C(NCCCc1cnc[nH]1)NCCCN(Cc1cccc2ccccc12)c1ccc(Br)cn1 |
| InChI | InChI=1S/C26H29BrN6S/c27-22-11-12-25(31-16-22)33(18-21-8-3-7-20-6-1-2-10-24(20)21)15-5-14-30-26(34)29-13-4-9-23-17-28-19-32-23/h1-3,6-8,10-12,16-17,19H,4-5,9,13-15,18H2,(H,28,32)(H2,29,30,34) |
| InChIKey | DSZPBHJWOKFYBU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|