C12H19NS2 — CID 103701176
2-methylsulfanyl-N-[(5-methylthiophen-2-yl)methyl]cyclopentan-1-amine (PubChem CID 103701176) has the molecular formula C12H19NS2 and a molecular weight of 241.42 g/mol. Its IUPAC name is 2-methylsulfanyl-N-[(5-methylthiophen-2-yl)methyl]cyclopentan-1-amine.
| Compound Name | 2-methylsulfanyl-N-[(5-methylthiophen-2-yl)methyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 103701176 |
| Molecular Formula | C12H19NS2 |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-methylsulfanyl-N-[(5-methylthiophen-2-yl)methyl]cyclopentan-1-amine |
| SMILES | CSC1CCCC1NCc1ccc(C)s1 |
| InChI | InChI=1S/C12H19NS2/c1-9-6-7-10(15-9)8-13-11-4-3-5-12(11)14-2/h6-7,11-13H,3-5,8H2,1-2H3 |
| InChIKey | VKXVBBPWCGXFDD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |