C15H19NO — CID 103701789
N-[(2-prop-2-enoxyphenyl)methyl]pent-4-yn-1-amine (PubChem CID 103701789) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is N-[(2-prop-2-enoxyphenyl)methyl]pent-4-yn-1-amine.
| Compound Name | N-[(2-prop-2-enoxyphenyl)methyl]pent-4-yn-1-amine |
|---|---|
| PubChem CID | 103701789 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | N-[(2-prop-2-enoxyphenyl)methyl]pent-4-yn-1-amine |
| SMILES | C#CCCCNCc1ccccc1OCC=C |
| InChI | InChI=1S/C15H19NO/c1-3-5-8-11-16-13-14-9-6-7-10-15(14)17-12-4-2/h1,4,6-7,9-10,16H,2,5,8,11-13H2 |
| InChIKey | DFRUROKCUNTDNI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|