C15H20F3NO — CID 115491359
5,5,5-trifluoro-N-[(2-prop-2-enoxyphenyl)methyl]pentan-1-amine (PubChem CID 115491359) has the molecular formula C15H20F3NO and a molecular weight of 287.33 g/mol. Its IUPAC name is 5,5,5-trifluoro-N-[(2-prop-2-enoxyphenyl)methyl]pentan-1-amine.
| Compound Name | 5,5,5-trifluoro-N-[(2-prop-2-enoxyphenyl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 115491359 |
| Molecular Formula | C15H20F3NO |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 5,5,5-trifluoro-N-[(2-prop-2-enoxyphenyl)methyl]pentan-1-amine |
| SMILES | C=CCOc1ccccc1CNCCCCC(F)(F)F |
| InChI | InChI=1S/C15H20F3NO/c1-2-11-20-14-8-4-3-7-13(14)12-19-10-6-5-9-15(16,17)18/h2-4,7-8,19H,1,5-6,9-12H2 |
| InChIKey | RRQQVIDCWFOXHP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|