C11H13N3OS — CID 103702635
3-[(5-ethylthiophen-2-yl)methylamino]-1H-pyrazin-2-one (PubChem CID 103702635) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 3-[(5-ethylthiophen-2-yl)methylamino]-1H-pyrazin-2-one.
| Compound Name | 3-[(5-ethylthiophen-2-yl)methylamino]-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 103702635 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 3-[(5-ethylthiophen-2-yl)methylamino]-1H-pyrazin-2-one |
| SMILES | CCc1ccc(CNc2ncc[nH]c2=O)s1 |
| InChI | InChI=1S/C11H13N3OS/c1-2-8-3-4-9(16-8)7-14-10-11(15)13-6-5-12-10/h3-6H,2,7H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | FDIXOELSECXRFM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |