C10H12ClN3 — CID 103705061
6-chloro-2-methyl-N-pent-4-yn-2-ylpyrimidin-4-amine (PubChem CID 103705061) has the molecular formula C10H12ClN3 and a molecular weight of 209.68 g/mol. Its IUPAC name is 6-chloro-2-methyl-N-pent-4-yn-2-ylpyrimidin-4-amine.
| Compound Name | 6-chloro-2-methyl-N-pent-4-yn-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 103705061 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 6-chloro-2-methyl-N-pent-4-yn-2-ylpyrimidin-4-amine |
| SMILES | C#CCC(C)Nc1cc(Cl)nc(C)n1 |
| InChI | InChI=1S/C10H12ClN3/c1-4-5-7(2)12-10-6-9(11)13-8(3)14-10/h1,6-7H,5H2,2-3H3,(H,12,13,14) |
| InChIKey | PGBHPMBCESQLCZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|