C14H15N5O — CID 103706853
N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1H-indole-7-carboxamide (PubChem CID 103706853) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1H-indole-7-carboxamide.
| Compound Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 103706853 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1H-indole-7-carboxamide |
| SMILES | CCn1cnnc1CNC(=O)c1cccc2cc[nH]c12 |
| InChI | InChI=1S/C14H15N5O/c1-2-19-9-17-18-12(19)8-16-14(20)11-5-3-4-10-6-7-15-13(10)11/h3-7,9,15H,2,8H2,1H3,(H,16,20) |
| InChIKey | RBEBGCNJEAZWLX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |