C28H42F3N3O6 — CID 10370854
3-[[(1R,2S,5S)-3-[(2S)-2-cyclohexyl-2-(3,3-dimethylbutanoylamino)acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-6,6,6-trifluoro-2-oxohexanoic acid (PubChem CID 10370854) has the molecular formula C28H42F3N3O6 and a molecular weight of 573.65 g/mol. Its IUPAC name is 3-[[(1R,2S,5S)-3-[(2S)-2-cyclohexyl-2-(3,3-dimethylbutanoylamino)acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-6,6,6-trifluoro-2-oxohexanoic acid.
| Compound Name | 3-[[(1R,2S,5S)-3-[(2S)-2-cyclohexyl-2-(3,3-dimethylbutanoylamino)acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-6,6,6-trifluoro-2-oxohexanoic acid |
|---|---|
| PubChem CID | 10370854 |
| Molecular Formula | C28H42F3N3O6 |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | 3-[[(1R,2S,5S)-3-[(2S)-2-cyclohexyl-2-(3,3-dimethylbutanoylamino)acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-6,6,6-trifluoro-2-oxohexanoic acid |
| SMILES | CC(C)(C)CC(=O)N[C@H](C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)NC(CCC(F)(F)F)C(=O)C(=O)O)C2(C)C)C1CCCCC1 |
| InChI | InChI=1S/C28H42F3N3O6/c1-26(2,3)13-18(35)33-20(15-9-7-6-8-10-15)24(38)34-14-16-19(27(16,4)5)21(34)23(37)32-17(22(36)25(39)40)11-12-28(29,30)31/h15-17,19-21H,6-14H2,1-5H3,(H,32,37)(H,33,35)(H,39,40)/t16-,17?,19-,20-,21-/m0/s1 |
| InChIKey | ADOWEYMVAQTJBO-CMFUAUOHSA-N |
| XLogP | 3.45 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|