C26H39F3N4O6 — CID 71178279
tert-butyl N-[(1S)-2-[(2S)-2-[(5-amino-1,1,1-trifluoro-4,5-dioxopentan-3-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate (PubChem CID 71178279) has the molecular formula C26H39F3N4O6 and a molecular weight of 560.61 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-[(2S)-2-[(5-amino-1,1,1-trifluoro-4,5-dioxopentan-3-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-[(2S)-2-[(5-amino-1,1,1-trifluoro-4,5-dioxopentan-3-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 71178279 |
| Molecular Formula | C26H39F3N4O6 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | tert-butyl N-[(1S)-2-[(2S)-2-[(5-amino-1,1,1-trifluoro-4,5-dioxopentan-3-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)N1CC2C([C@H]1C(=O)NC(CC(F)(F)F)C(=O)C(N)=O)C2(C)C)C1CCCCC1 |
| InChI | InChI=1S/C26H39F3N4O6/c1-24(2,3)39-23(38)32-17(13-9-7-6-8-10-13)22(37)33-12-14-16(25(14,4)5)18(33)21(36)31-15(11-26(27,28)29)19(34)20(30)35/h13-18H,6-12H2,1-5H3,(H2,30,35)(H,31,36)(H,32,38)/t14?,15?,16?,17-,18-/m0/s1 |
| InChIKey | YWYOZQKXLGRBAH-PAOLREHBSA-N |
| XLogP | 2.43 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|