C31H50N4O6 — CID 58987171
tert-butyl N-[2-[(1R,2S,5S)-2-[(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)carbamoyl]-6,6,7,7-tetramethyl-3-azabicyclo[3.2.0]heptan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate (PubChem CID 58987171) has the molecular formula C31H50N4O6 and a molecular weight of 574.76 g/mol. Its IUPAC name is tert-butyl N-[2-[(1R,2S,5S)-2-[(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)carbamoyl]-6,6,7,7-tetramethyl-3-azabicyclo[3.2.0]heptan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(1R,2S,5S)-2-[(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)carbamoyl]-6,6,7,7-tetramethyl-3-azabicyclo[3.2.0]heptan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 58987171 |
| Molecular Formula | C31H50N4O6 |
| Molecular Weight | 574.76 g/mol |
| Exact Mass | 574.37 |
| IUPAC Name | tert-butyl N-[2-[(1R,2S,5S)-2-[(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)carbamoyl]-6,6,7,7-tetramethyl-3-azabicyclo[3.2.0]heptan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)NC(CC1CC1)C(=O)C(N)=O)C(C)(C)C2(C)C)C1CCCCC1 |
| InChI | InChI=1S/C31H50N4O6/c1-29(2,3)41-28(40)34-22(18-11-9-8-10-12-18)27(39)35-16-19-21(31(6,7)30(19,4)5)23(35)26(38)33-20(15-17-13-14-17)24(36)25(32)37/h17-23H,8-16H2,1-7H3,(H2,32,37)(H,33,38)(H,34,40)/t19-,20?,21-,22?,23-/m0/s1 |
| InChIKey | AMBXAWONDICHBY-CMYURLEYSA-N |
| XLogP | 3.31 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.76 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|