C10H17N3S — CID 103709997
1-[(1-methylpyrrol-2-yl)methyl]-3-propan-2-ylthiourea (PubChem CID 103709997) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is 1-[(1-methylpyrrol-2-yl)methyl]-3-propan-2-ylthiourea.
| Compound Name | 1-[(1-methylpyrrol-2-yl)methyl]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 103709997 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 1-[(1-methylpyrrol-2-yl)methyl]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)NCc1cccn1C |
| InChI | InChI=1S/C10H17N3S/c1-8(2)12-10(14)11-7-9-5-4-6-13(9)3/h4-6,8H,7H2,1-3H3,(H2,11,12,14) |
| InChIKey | LDPNKGYZRIFIGL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 28.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_D(5)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|