C8H15N5S — CID 103882237
1-[(1-methyl-1,2,4-triazol-3-yl)methyl]-3-propan-2-ylthiourea (PubChem CID 103882237) has the molecular formula C8H15N5S and a molecular weight of 213.31 g/mol. Its IUPAC name is 1-[(1-methyl-1,2,4-triazol-3-yl)methyl]-3-propan-2-ylthiourea.
| Compound Name | 1-[(1-methyl-1,2,4-triazol-3-yl)methyl]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 103882237 |
| Molecular Formula | C8H15N5S |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 1-[(1-methyl-1,2,4-triazol-3-yl)methyl]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)NCc1ncn(C)n1 |
| InChI | InChI=1S/C8H15N5S/c1-6(2)11-8(14)9-4-7-10-5-13(3)12-7/h5-6H,4H2,1-3H3,(H2,9,11,14) |
| InChIKey | RIXXJZHJCWVKOH-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|