About (E)-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]but-2-enamide
(E)-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]but-2-enamide (PubChem CID 103886026) has the molecular formula C8H12N4O
and a molecular weight of 180.21 g/mol. Its IUPAC name is (E)-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]but-2-enamide.
Molecular Properties
| Compound Name | (E)-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]but-2-enamide |
| PubChem CID | 103886026 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | (E)-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]but-2-enamide |
| SMILES | C/C=C/C(=O)NCc1ncn(C)n1 |
| InChI | InChI=1S/C8H12N4O/c1-3-4-8(13)9-5-7-10-6-12(2)11-7/h3-4,6H,5H2,1-2H3,(H,9,13)/b4-3+ |
| InChIKey | ITPWTBZUHYGOGY-ONEGZZNKSA-N |
| XLogP | 0.01 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]but-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]but-2-enamide?
The IUPAC name of (E)-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]but-2-enamide (CID 103886026) is (E)-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]but-2-enamide.
What is the SMILES notation for (E)-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]but-2-enamide?
The canonical SMILES for (E)-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]but-2-enamide is C/C=C/C(=O)NCc1ncn(C)n1.
What is the InChIKey of (E)-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]but-2-enamide?
The InChIKey is ITPWTBZUHYGOGY-ONEGZZNKSA-N. The full InChI is InChI=1S/C8H12N4O/c1-3-4-8(13)9-5-7-10-6-12(2)11-7/h3-4,6H,5H2,1-2H3,(H,9,13)/b4-3+.
What are the key properties of (E)-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]but-2-enamide?
(E)-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]but-2-enamide has a molecular weight of 180.21 g/mol, XLogP of 0.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]but-2-enamide is sourced from PubChem (CID 103886026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).