C10H15N5O3 — CID 114126259
2-[(1-methyl-1,2,4-triazol-3-yl)methylcarbamoylamino]pent-4-enoic acid (PubChem CID 114126259) has the molecular formula C10H15N5O3 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-[(1-methyl-1,2,4-triazol-3-yl)methylcarbamoylamino]pent-4-enoic acid.
| Compound Name | 2-[(1-methyl-1,2,4-triazol-3-yl)methylcarbamoylamino]pent-4-enoic acid |
|---|---|
| PubChem CID | 114126259 |
| Molecular Formula | C10H15N5O3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-[(1-methyl-1,2,4-triazol-3-yl)methylcarbamoylamino]pent-4-enoic acid |
| SMILES | C=CCC(NC(=O)NCc1ncn(C)n1)C(=O)O |
| InChI | InChI=1S/C10H15N5O3/c1-3-4-7(9(16)17)13-10(18)11-5-8-12-6-15(2)14-8/h3,6-7H,1,4-5H2,2H3,(H,16,17)(H2,11,13,18) |
| InChIKey | FFUSHXQQUMIIIZ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|