C9H12BrN3O — CID 131247580
(E)-N-[(4-bromo-1-methylpyrazol-3-yl)methyl]but-2-enamide (PubChem CID 131247580) has the molecular formula C9H12BrN3O and a molecular weight of 258.12 g/mol. Its IUPAC name is (E)-N-[(4-bromo-1-methylpyrazol-3-yl)methyl]but-2-enamide.
| Compound Name | (E)-N-[(4-bromo-1-methylpyrazol-3-yl)methyl]but-2-enamide |
|---|---|
| PubChem CID | 131247580 |
| Molecular Formula | C9H12BrN3O |
| Molecular Weight | 258.12 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | (E)-N-[(4-bromo-1-methylpyrazol-3-yl)methyl]but-2-enamide |
| SMILES | C/C=C/C(=O)NCc1nn(C)cc1Br |
| InChI | InChI=1S/C9H12BrN3O/c1-3-4-9(14)11-5-8-7(10)6-13(2)12-8/h3-4,6H,5H2,1-2H3,(H,11,14)/b4-3+ |
| InChIKey | DICKDTZJJVODJF-ONEGZZNKSA-N |
| XLogP | 1.37 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.12 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|