C9H14N4O — CID 139021125
N-[3-(1-methyl-1,2,4-triazol-3-yl)propyl]prop-2-enamide (PubChem CID 139021125) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is N-[3-(1-methyl-1,2,4-triazol-3-yl)propyl]prop-2-enamide.
| Compound Name | N-[3-(1-methyl-1,2,4-triazol-3-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 139021125 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | N-[3-(1-methyl-1,2,4-triazol-3-yl)propyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCc1ncn(C)n1 |
| InChI | InChI=1S/C9H14N4O/c1-3-9(14)10-6-4-5-8-11-7-13(2)12-8/h3,7H,1,4-6H2,2H3,(H,10,14) |
| InChIKey | PGCYTMAPWNXSMM-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|