C13H16INO — CID 103713511
3-iodo-N-(2-propylcyclopropyl)benzamide (PubChem CID 103713511) has the molecular formula C13H16INO and a molecular weight of 329.18 g/mol. Its IUPAC name is 3-iodo-N-(2-propylcyclopropyl)benzamide.
| Compound Name | 3-iodo-N-(2-propylcyclopropyl)benzamide |
|---|---|
| PubChem CID | 103713511 |
| Molecular Formula | C13H16INO |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 3-iodo-N-(2-propylcyclopropyl)benzamide |
| SMILES | CCCC1CC1NC(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C13H16INO/c1-2-4-9-8-12(9)15-13(16)10-5-3-6-11(14)7-10/h3,5-7,9,12H,2,4,8H2,1H3,(H,15,16) |
| InChIKey | CSNOPVIYKFCBKK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|