C13H21NO2 — CID 103714081
methyl (3S)-1-cyclohex-2-en-1-ylpiperidine-3-carboxylate (PubChem CID 103714081) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is methyl (3S)-1-cyclohex-2-en-1-ylpiperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-cyclohex-2-en-1-ylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 103714081 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | methyl (3S)-1-cyclohex-2-en-1-ylpiperidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN(C2C=CCCC2)C1 |
| InChI | InChI=1S/C13H21NO2/c1-16-13(15)11-6-5-9-14(10-11)12-7-3-2-4-8-12/h3,7,11-12H,2,4-6,8-10H2,1H3/t11-,12?/m0/s1 |
| InChIKey | IGPYLACGKUJFLA-PXYINDEMSA-N |
| XLogP | 1.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|