C14H23NO3 — CID 114228063
methyl 4-[(2E)-cyclooct-2-en-1-yl]morpholine-2-carboxylate (PubChem CID 114228063) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is methyl 4-[(2E)-cyclooct-2-en-1-yl]morpholine-2-carboxylate.
| Compound Name | methyl 4-[(2E)-cyclooct-2-en-1-yl]morpholine-2-carboxylate |
|---|---|
| PubChem CID | 114228063 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | methyl 4-[(2E)-cyclooct-2-en-1-yl]morpholine-2-carboxylate |
| SMILES | COC(=O)C1CN(C2/C=C\CCCCC2)CCO1 |
| InChI | InChI=1S/C14H23NO3/c1-17-14(16)13-11-15(9-10-18-13)12-7-5-3-2-4-6-8-12/h5,7,12-13H,2-4,6,8-11H2,1H3/b7-5- |
| InChIKey | XQXIJBWKABHLMJ-ALCCZGGFSA-N |
| XLogP | 1.75 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|