C13H21NO3 — CID 96999144
methyl 2-[(2R)-4-[(1R)-cyclohex-2-en-1-yl]morpholin-2-yl]acetate (PubChem CID 96999144) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is methyl 2-[(2R)-4-[(1R)-cyclohex-2-en-1-yl]morpholin-2-yl]acetate.
| Compound Name | methyl 2-[(2R)-4-[(1R)-cyclohex-2-en-1-yl]morpholin-2-yl]acetate |
|---|---|
| PubChem CID | 96999144 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | methyl 2-[(2R)-4-[(1R)-cyclohex-2-en-1-yl]morpholin-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1CN([C@H]2C=CCCC2)CCO1 |
| InChI | InChI=1S/C13H21NO3/c1-16-13(15)9-12-10-14(7-8-17-12)11-5-3-2-4-6-11/h3,5,11-12H,2,4,6-10H2,1H3/t11-,12+/m0/s1 |
| InChIKey | WOKDJWIFJQSRFL-NWDGAFQWSA-N |
| XLogP | 1.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|